C21H23NO4S — CID 9056065
3,4-diethoxy-N-methyl-N-naphthalen-2-ylbenzenesulfonamide (PubChem CID 9056065) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 3,4-diethoxy-N-methyl-N-naphthalen-2-ylbenzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-methyl-N-naphthalen-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 9056065 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 3,4-diethoxy-N-methyl-N-naphthalen-2-ylbenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(C)c2ccc3ccccc3c2)cc1OCC |
| InChI | InChI=1S/C21H23NO4S/c1-4-25-20-13-12-19(15-21(20)26-5-2)27(23,24)22(3)18-11-10-16-8-6-7-9-17(16)14-18/h6-15H,4-5H2,1-3H3 |
| InChIKey | FFENEXGCZKBAQW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |