C28H27F3O11 — CID 57139203
4,4,4-trifluoro-1-naphthalen-2-yl-3-[(2S,3R,4S,5S,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(2-hydroxypropanoyl)oxan-2-yl]oxybut-2-en-1-one (PubChem CID 57139203) has the molecular formula C28H27F3O11 and a molecular weight of 596.51 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-naphthalen-2-yl-3-[(2S,3R,4S,5S,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(2-hydroxypropanoyl)oxan-2-yl]oxybut-2-en-1-one.
| Compound Name | 4,4,4-trifluoro-1-naphthalen-2-yl-3-[(2S,3R,4S,5S,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(2-hydroxypropanoyl)oxan-2-yl]oxybut-2-en-1-one |
|---|---|
| PubChem CID | 57139203 |
| Molecular Formula | C28H27F3O11 |
| Molecular Weight | 596.51 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | 4,4,4-trifluoro-1-naphthalen-2-yl-3-[(2S,3R,4S,5S,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(2-hydroxypropanoyl)oxan-2-yl]oxybut-2-en-1-one |
| SMILES | CC(=O)[C@@]1(O)[C@](O)(C(C)=O)[C@H](OC(=CC(=O)c2ccc3ccccc3c2)C(F)(F)F)O[C@H](C(=O)C(C)O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C28H27F3O11/c1-13(32)22(37)23-25(38,14(2)33)27(40,16(4)35)26(39,15(3)34)24(42-23)41-21(28(29,30)31)12-20(36)19-10-9-17-7-5-6-8-18(17)11-19/h5-13,23-24,32,38-40H,1-4H3/t13?,23-,24-,25+,26+,27+/m1/s1 |
| InChIKey | CHXMJDUERBIZOU-DOQYRAPASA-N |
| XLogP | 1.12 |
| TPSA | 184.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|