About (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate
(2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate (PubChem CID 134263039) has the molecular formula C36H24O4
and a molecular weight of 520.58 g/mol. Its IUPAC name is (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate.
Molecular Properties
| Compound Name | (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate |
| PubChem CID | 134263039 |
| Molecular Formula | C36H24O4 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate |
| SMILES | O=C(OC(=C(OC(=O)c1ccccc1)c1ccc2ccccc2c1)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C36H24O4/c37-35(27-13-3-1-4-14-27)39-33(31-21-19-25-11-7-9-17-29(25)23-31)34(40-36(38)28-15-5-2-6-16-28)32-22-20-26-12-8-10-18-30(26)24-32/h1-24H |
| InChIKey | WRVUGBSGQRGUBP-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate?
The IUPAC name of (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate (CID 134263039) is (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate.
What is the SMILES notation for (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate?
The canonical SMILES for (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate is O=C(OC(=C(OC(=O)c1ccccc1)c1ccc2ccccc2c1)c1ccc2ccccc2c1)c1ccccc1.
What is the InChIKey of (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate?
The InChIKey is WRVUGBSGQRGUBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H24O4/c37-35(27-13-3-1-4-14-27)39-33(31-21-19-25-11-7-9-17-29(25)23-31)34(40-36(38)28-15-5-2-6-16-28)32-22-20-26-12-8-10-18-30(26)24-32/h1-24H.
What are the key properties of (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate?
(2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate has a molecular weight of 520.58 g/mol, XLogP of 8.53, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzoyloxy-1,2-dinaphthalen-2-ylethenyl) benzoate is sourced from PubChem (CID 134263039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).