C13H7F9O — CID 86161287
4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylhept-2-en-1-one (PubChem CID 86161287) has the molecular formula C13H7F9O and a molecular weight of 350.18 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylhept-2-en-1-one.
| Compound Name | 4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylhept-2-en-1-one |
|---|---|
| PubChem CID | 86161287 |
| Molecular Formula | C13H7F9O |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylhept-2-en-1-one |
| SMILES | O=C(C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H7F9O/c14-10(15,11(16,17)12(18,19)13(20,21)22)7-6-9(23)8-4-2-1-3-5-8/h1-7H |
| InChIKey | MIPIUELEMUANSH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|