C14H14Cl3NO2 — CID 11844683
2,2,2-trichloro-N-[(Z)-4-methyl-3-oxo-1-phenylpent-1-enyl]acetamide (PubChem CID 11844683) has the molecular formula C14H14Cl3NO2 and a molecular weight of 334.63 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(Z)-4-methyl-3-oxo-1-phenylpent-1-enyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(Z)-4-methyl-3-oxo-1-phenylpent-1-enyl]acetamide |
|---|---|
| PubChem CID | 11844683 |
| Molecular Formula | C14H14Cl3NO2 |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2,2,2-trichloro-N-[(Z)-4-methyl-3-oxo-1-phenylpent-1-enyl]acetamide |
| SMILES | CC(C)C(=O)/C=C(\NC(=O)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H14Cl3NO2/c1-9(2)12(19)8-11(10-6-4-3-5-7-10)18-13(20)14(15,16)17/h3-9H,1-2H3,(H,18,20)/b11-8- |
| InChIKey | FUEGMHNEPVYNET-FLIBITNWSA-N |
| XLogP | 3.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|