C12H10Cl3NO2 — CID 11844676
2,2,2-trichloro-N-[(Z)-3-oxo-2-phenylbut-1-enyl]acetamide (PubChem CID 11844676) has the molecular formula C12H10Cl3NO2 and a molecular weight of 306.58 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(Z)-3-oxo-2-phenylbut-1-enyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(Z)-3-oxo-2-phenylbut-1-enyl]acetamide |
|---|---|
| PubChem CID | 11844676 |
| Molecular Formula | C12H10Cl3NO2 |
| Molecular Weight | 306.58 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 2,2,2-trichloro-N-[(Z)-3-oxo-2-phenylbut-1-enyl]acetamide |
| SMILES | CC(=O)/C(=C\NC(=O)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C12H10Cl3NO2/c1-8(17)10(9-5-3-2-4-6-9)7-16-11(18)12(13,14)15/h2-7H,1H3,(H,16,18)/b10-7+ |
| InChIKey | NXUBJSYLYMYRIL-JXMROGBWSA-N |
| XLogP | 3.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|