C20H21NO3 — CID 102299586
(2S)-3-methyl-2-[[(Z)-3-oxo-1,3-diphenylprop-1-enyl]amino]butanoic acid (PubChem CID 102299586) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(Z)-3-oxo-1,3-diphenylprop-1-enyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(Z)-3-oxo-1,3-diphenylprop-1-enyl]amino]butanoic acid |
|---|---|
| PubChem CID | 102299586 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2S)-3-methyl-2-[[(Z)-3-oxo-1,3-diphenylprop-1-enyl]amino]butanoic acid |
| SMILES | CC(C)[C@H](N/C(=C\C(=O)c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H21NO3/c1-14(2)19(20(23)24)21-17(15-9-5-3-6-10-15)13-18(22)16-11-7-4-8-12-16/h3-14,19,21H,1-2H3,(H,23,24)/b17-13-/t19-/m0/s1 |
| InChIKey | ILLNRFDCDIRDPY-LYDJUCFBSA-N |
| XLogP | 3.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|