C25H26N2O — CID 51411566
(E)-3-phenyl-N-[(1R)-1-phenylethyl]-3-[[(1S)-1-phenylethyl]amino]prop-2-enamide (PubChem CID 51411566) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is (E)-3-phenyl-N-[(1R)-1-phenylethyl]-3-[[(1S)-1-phenylethyl]amino]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[(1R)-1-phenylethyl]-3-[[(1S)-1-phenylethyl]amino]prop-2-enamide |
|---|---|
| PubChem CID | 51411566 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (E)-3-phenyl-N-[(1R)-1-phenylethyl]-3-[[(1S)-1-phenylethyl]amino]prop-2-enamide |
| SMILES | C[C@H](N/C(=C/C(=O)N[C@H](C)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O/c1-19(21-12-6-3-7-13-21)26-24(23-16-10-5-11-17-23)18-25(28)27-20(2)22-14-8-4-9-15-22/h3-20,26H,1-2H3,(H,27,28)/b24-18+/t19-,20+/m0/s1 |
| InChIKey | RELZJOZXRBOZIZ-SSPHSRQNSA-N |
| XLogP | 5.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|