C15H12Cl3NO — CID 3685786
N-benzhydryl-2,2,2-trichloroacetamide (PubChem CID 3685786) has the molecular formula C15H12Cl3NO and a molecular weight of 328.63 g/mol. Its IUPAC name is N-benzhydryl-2,2,2-trichloroacetamide.
| Compound Name | N-benzhydryl-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 3685786 |
| Molecular Formula | C15H12Cl3NO |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | N-benzhydryl-2,2,2-trichloroacetamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H12Cl3NO/c16-15(17,18)14(20)19-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,19,20) |
| InChIKey | MODKQCKGEXNUNZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|