C22H12ClF16NO — CID 5078703
N-benzhydryl-9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide (PubChem CID 5078703) has the molecular formula C22H12ClF16NO and a molecular weight of 645.77 g/mol. Its IUPAC name is N-benzhydryl-9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide.
| Compound Name | N-benzhydryl-9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
|---|---|
| PubChem CID | 5078703 |
| Molecular Formula | C22H12ClF16NO |
| Molecular Weight | 645.77 g/mol |
| Exact Mass | 645.04 |
| IUPAC Name | N-benzhydryl-9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C22H12ClF16NO/c23-22(38,39)21(36,37)20(34,35)19(32,33)18(30,31)17(28,29)16(26,27)15(24,25)14(41)40-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,40,41) |
| InChIKey | QZNVLYGDCVJAHG-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.77 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|