C22H18Cl3NO2 — CID 141460975
2,2,2-trichloro-N-(1-hydroxy-1,2,2-triphenylethyl)acetamide (PubChem CID 141460975) has the molecular formula C22H18Cl3NO2 and a molecular weight of 434.75 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(1-hydroxy-1,2,2-triphenylethyl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(1-hydroxy-1,2,2-triphenylethyl)acetamide |
|---|---|
| PubChem CID | 141460975 |
| Molecular Formula | C22H18Cl3NO2 |
| Molecular Weight | 434.75 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 2,2,2-trichloro-N-(1-hydroxy-1,2,2-triphenylethyl)acetamide |
| SMILES | O=C(NC(O)(c1ccccc1)C(c1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H18Cl3NO2/c23-22(24,25)20(27)26-21(28,18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15,19,28H,(H,26,27) |
| InChIKey | GBSKOTDOYZWADA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|