C15H16Cl3N3O2 — CID 73123566
2,2,2-trichloro-N-(2-diazo-4,4-dimethyl-3-oxo-1-phenylpentyl)acetamide (PubChem CID 73123566) has the molecular formula C15H16Cl3N3O2 and a molecular weight of 376.67 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(2-diazo-4,4-dimethyl-3-oxo-1-phenylpentyl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(2-diazo-4,4-dimethyl-3-oxo-1-phenylpentyl)acetamide |
|---|---|
| PubChem CID | 73123566 |
| Molecular Formula | C15H16Cl3N3O2 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 2,2,2-trichloro-N-(2-diazo-4,4-dimethyl-3-oxo-1-phenylpentyl)acetamide |
| SMILES | CC(C)(C)C(=O)C(=[N+]=[N-])C(NC(=O)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C15H16Cl3N3O2/c1-14(2,3)12(22)11(21-19)10(9-7-5-4-6-8-9)20-13(23)15(16,17)18/h4-8,10H,1-3H3,(H,20,23) |
| InChIKey | UTRUDEQAJFOLHL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|