C16H18N2O — CID 2228466
3-benzhydryl-1,1-dimethylurea (PubChem CID 2228466) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-benzhydryl-1,1-dimethylurea.
| Compound Name | 3-benzhydryl-1,1-dimethylurea |
|---|---|
| PubChem CID | 2228466 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-benzhydryl-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O/c1-18(2)16(19)17-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,1-2H3,(H,17,19) |
| InChIKey | JNUSADKECAXTAM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |