C16H18BrN3O — CID 40598667
3-[(S)-(2-amino-5-bromophenyl)-phenylmethyl]-1,1-dimethylurea (PubChem CID 40598667) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is 3-[(S)-(2-amino-5-bromophenyl)-phenylmethyl]-1,1-dimethylurea.
| Compound Name | 3-[(S)-(2-amino-5-bromophenyl)-phenylmethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 40598667 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 3-[(S)-(2-amino-5-bromophenyl)-phenylmethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N[C@@H](c1ccccc1)c1cc(Br)ccc1N |
| InChI | InChI=1S/C16H18BrN3O/c1-20(2)16(21)19-15(11-6-4-3-5-7-11)13-10-12(17)8-9-14(13)18/h3-10,15H,18H2,1-2H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | JXJMGRUPAPLWSZ-HNNXBMFYSA-N |
| XLogP | 3.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|