C15H14BrClN2O2 — CID 3844549
2-[[(2-amino-5-bromophenyl)-(2-chlorophenyl)methyl]amino]acetic acid (PubChem CID 3844549) has the molecular formula C15H14BrClN2O2 and a molecular weight of 369.65 g/mol. Its IUPAC name is 2-[[(2-amino-5-bromophenyl)-(2-chlorophenyl)methyl]amino]acetic acid.
| Compound Name | 2-[[(2-amino-5-bromophenyl)-(2-chlorophenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 3844549 |
| Molecular Formula | C15H14BrClN2O2 |
| Molecular Weight | 369.65 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 2-[[(2-amino-5-bromophenyl)-(2-chlorophenyl)methyl]amino]acetic acid |
| SMILES | Nc1ccc(Br)cc1C(NCC(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C15H14BrClN2O2/c16-9-5-6-13(18)11(7-9)15(19-8-14(20)21)10-3-1-2-4-12(10)17/h1-7,15,19H,8,18H2,(H,20,21) |
| InChIKey | IOUGWNXFQMYDSI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.65 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|