C19H19BrCl2N2O3 — CID 3108122
methyl 2-[[[5-bromo-2-(3-chloropropanoylamino)phenyl]-(2-chlorophenyl)methyl]amino]acetate (PubChem CID 3108122) has the molecular formula C19H19BrCl2N2O3 and a molecular weight of 474.18 g/mol. Its IUPAC name is methyl 2-[[[5-bromo-2-(3-chloropropanoylamino)phenyl]-(2-chlorophenyl)methyl]amino]acetate.
| Compound Name | methyl 2-[[[5-bromo-2-(3-chloropropanoylamino)phenyl]-(2-chlorophenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 3108122 |
| Molecular Formula | C19H19BrCl2N2O3 |
| Molecular Weight | 474.18 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | methyl 2-[[[5-bromo-2-(3-chloropropanoylamino)phenyl]-(2-chlorophenyl)methyl]amino]acetate |
| SMILES | COC(=O)CNC(c1ccccc1Cl)c1cc(Br)ccc1NC(=O)CCCl |
| InChI | InChI=1S/C19H19BrCl2N2O3/c1-27-18(26)11-23-19(13-4-2-3-5-15(13)22)14-10-12(20)6-7-16(14)24-17(25)8-9-21/h2-7,10,19,23H,8-9,11H2,1H3,(H,24,25) |
| InChIKey | YZIKSTBONXQWAI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.18 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|