C19H20BrClN2O3 — CID 3108120
methyl 2-[[[5-bromo-2-(3-chloropropanoylamino)phenyl]-phenylmethyl]amino]acetate (PubChem CID 3108120) has the molecular formula C19H20BrClN2O3 and a molecular weight of 439.74 g/mol. Its IUPAC name is methyl 2-[[[5-bromo-2-(3-chloropropanoylamino)phenyl]-phenylmethyl]amino]acetate.
| Compound Name | methyl 2-[[[5-bromo-2-(3-chloropropanoylamino)phenyl]-phenylmethyl]amino]acetate |
|---|---|
| PubChem CID | 3108120 |
| Molecular Formula | C19H20BrClN2O3 |
| Molecular Weight | 439.74 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | methyl 2-[[[5-bromo-2-(3-chloropropanoylamino)phenyl]-phenylmethyl]amino]acetate |
| SMILES | COC(=O)CNC(c1ccccc1)c1cc(Br)ccc1NC(=O)CCCl |
| InChI | InChI=1S/C19H20BrClN2O3/c1-26-18(25)12-22-19(13-5-3-2-4-6-13)15-11-14(20)7-8-16(15)23-17(24)9-10-21/h2-8,11,19,22H,9-10,12H2,1H3,(H,23,24) |
| InChIKey | JLMVEIXYSNRTOI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|