C23H23BrN4O3 — CID 1162899
N-[4-bromo-2-[(S)-[(2-hydrazinyl-2-oxoethyl)amino]-phenylmethyl]phenyl]-4-methoxybenzamide (PubChem CID 1162899) has the molecular formula C23H23BrN4O3 and a molecular weight of 483.37 g/mol. Its IUPAC name is N-[4-bromo-2-[(S)-[(2-hydrazinyl-2-oxoethyl)amino]-phenylmethyl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[4-bromo-2-[(S)-[(2-hydrazinyl-2-oxoethyl)amino]-phenylmethyl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 1162899 |
| Molecular Formula | C23H23BrN4O3 |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | N-[4-bromo-2-[(S)-[(2-hydrazinyl-2-oxoethyl)amino]-phenylmethyl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Br)cc2[C@@H](NCC(=O)NN)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23BrN4O3/c1-31-18-10-7-16(8-11-18)23(30)27-20-12-9-17(24)13-19(20)22(26-14-21(29)28-25)15-5-3-2-4-6-15/h2-13,22,26H,14,25H2,1H3,(H,27,30)(H,28,29)/t22-/m0/s1 |
| InChIKey | ICLUSXDBEHEPCN-QFIPXVFZSA-N |
| XLogP | 3.38 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|