C23H21BrN2O3 — CID 27013660
2-[[(R)-[5-bromo-2-[(4-methoxyphenyl)methylideneamino]phenyl]-phenylmethyl]amino]acetic acid (PubChem CID 27013660) has the molecular formula C23H21BrN2O3 and a molecular weight of 453.34 g/mol. Its IUPAC name is 2-[[(R)-[5-bromo-2-[(4-methoxyphenyl)methylideneamino]phenyl]-phenylmethyl]amino]acetic acid.
| Compound Name | 2-[[(R)-[5-bromo-2-[(4-methoxyphenyl)methylideneamino]phenyl]-phenylmethyl]amino]acetic acid |
|---|---|
| PubChem CID | 27013660 |
| Molecular Formula | C23H21BrN2O3 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-[[(R)-[5-bromo-2-[(4-methoxyphenyl)methylideneamino]phenyl]-phenylmethyl]amino]acetic acid |
| SMILES | COc1ccc(/C=N/c2ccc(Br)cc2[C@H](NCC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21BrN2O3/c1-29-19-10-7-16(8-11-19)14-25-21-12-9-18(24)13-20(21)23(26-15-22(27)28)17-5-3-2-4-6-17/h2-14,23,26H,15H2,1H3,(H,27,28)/b25-14+/t23-/m1/s1 |
| InChIKey | IKJXWIBROSBOOV-RWOVVYLESA-N |
| XLogP | 4.97 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|