C23H22BrN2O3+ — CID 3510539
[[5-bromo-2-[(2-hydroxyphenyl)methylideneamino]phenyl]-phenylmethyl]-(2-methoxy-2-oxoethyl)azanium (PubChem CID 3510539) has the molecular formula C23H22BrN2O3+ and a molecular weight of 454.34 g/mol. Its IUPAC name is [[5-bromo-2-[(2-hydroxyphenyl)methylideneamino]phenyl]-phenylmethyl]-(2-methoxy-2-oxoethyl)azanium.
| Compound Name | [[5-bromo-2-[(2-hydroxyphenyl)methylideneamino]phenyl]-phenylmethyl]-(2-methoxy-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 3510539 |
| Molecular Formula | C23H22BrN2O3+ |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | [[5-bromo-2-[(2-hydroxyphenyl)methylideneamino]phenyl]-phenylmethyl]-(2-methoxy-2-oxoethyl)azanium |
| SMILES | COC(=O)C[NH2+]C(c1ccccc1)c1cc(Br)ccc1/N=C/c1ccccc1O |
| InChI | InChI=1S/C23H21BrN2O3/c1-29-22(28)15-26-23(16-7-3-2-4-8-16)19-13-18(24)11-12-20(19)25-14-17-9-5-6-10-21(17)27/h2-14,23,26-27H,15H2,1H3/p+1/b25-14+ |
| InChIKey | IFBLLVYNSONXNA-AFUMVMLFSA-O |
| XLogP | 3.73 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|