C24H23BrClN2O3+ — CID 5080723
[[5-bromo-2-[(3-chlorobenzoyl)amino]phenyl]-phenylmethyl]-(2-ethoxy-2-oxoethyl)azanium (PubChem CID 5080723) has the molecular formula C24H23BrClN2O3+ and a molecular weight of 502.82 g/mol. Its IUPAC name is [[5-bromo-2-[(3-chlorobenzoyl)amino]phenyl]-phenylmethyl]-(2-ethoxy-2-oxoethyl)azanium.
| Compound Name | [[5-bromo-2-[(3-chlorobenzoyl)amino]phenyl]-phenylmethyl]-(2-ethoxy-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 5080723 |
| Molecular Formula | C24H23BrClN2O3+ |
| Molecular Weight | 502.82 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | [[5-bromo-2-[(3-chlorobenzoyl)amino]phenyl]-phenylmethyl]-(2-ethoxy-2-oxoethyl)azanium |
| SMILES | CCOC(=O)C[NH2+]C(c1ccccc1)c1cc(Br)ccc1NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H22BrClN2O3/c1-2-31-22(29)15-27-23(16-7-4-3-5-8-16)20-14-18(25)11-12-21(20)28-24(30)17-9-6-10-19(26)13-17/h3-14,23,27H,2,15H2,1H3,(H,28,30)/p+1 |
| InChIKey | SLCAWLLNSLAEJA-UHFFFAOYSA-O |
| XLogP | 4.57 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.82 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |