C22H28BrN5O3 — CID 2870331
N-[4-bromo-2-[[(2-hydrazinyl-2-oxoethyl)amino]-phenylmethyl]phenyl]-3-morpholin-4-ylpropanamide (PubChem CID 2870331) has the molecular formula C22H28BrN5O3 and a molecular weight of 490.40 g/mol. Its IUPAC name is N-[4-bromo-2-[[(2-hydrazinyl-2-oxoethyl)amino]-phenylmethyl]phenyl]-3-morpholin-4-ylpropanamide.
| Compound Name | N-[4-bromo-2-[[(2-hydrazinyl-2-oxoethyl)amino]-phenylmethyl]phenyl]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 2870331 |
| Molecular Formula | C22H28BrN5O3 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-[4-bromo-2-[[(2-hydrazinyl-2-oxoethyl)amino]-phenylmethyl]phenyl]-3-morpholin-4-ylpropanamide |
| SMILES | NNC(=O)CNC(c1ccccc1)c1cc(Br)ccc1NC(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C22H28BrN5O3/c23-17-6-7-19(26-20(29)8-9-28-10-12-31-13-11-28)18(14-17)22(25-15-21(30)27-24)16-4-2-1-3-5-16/h1-7,14,22,25H,8-13,15,24H2,(H,26,29)(H,27,30) |
| InChIKey | QVMZLLLNHPRRCY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|