C32H24Cl2F6N2O2Ti — CID 11216193
bis((Z)-3-anilino-4,4,4-trifluoro-1-phenylbut-2-en-1-one);dichlorotitanium (PubChem CID 11216193) has the molecular formula C32H24Cl2F6N2O2Ti and a molecular weight of 701.32 g/mol. Its IUPAC name is bis((Z)-3-anilino-4,4,4-trifluoro-1-phenylbut-2-en-1-one);dichlorotitanium.
| Compound Name | bis((Z)-3-anilino-4,4,4-trifluoro-1-phenylbut-2-en-1-one);dichlorotitanium |
|---|---|
| PubChem CID | 11216193 |
| Molecular Formula | C32H24Cl2F6N2O2Ti |
| Molecular Weight | 701.32 g/mol |
| Exact Mass | 700.06 |
| IUPAC Name | bis((Z)-3-anilino-4,4,4-trifluoro-1-phenylbut-2-en-1-one);dichlorotitanium |
| SMILES | Cl[Ti]Cl.O=C(/C=C(\Nc1ccccc1)C(F)(F)F)c1ccccc1.O=C(/C=C(\Nc1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/2C16H12F3NO.2ClH.Ti/c2*17-16(18,19)15(20-13-9-5-2-6-10-13)11-14(21)12-7-3-1-4-8-12;;;/h2*1-11,20H;2*1H;/q;;;;+2/p-2/b2*15-11-;;; |
| InChIKey | KMVVADOZLBJWEO-ZOPFDXGDSA-L |
| XLogP | 10.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.32 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|