C16H11Cl2F3N2O — CID 110272456
(Z)-3-(3-chloroanilino)-N-(3-chlorophenyl)-4,4,4-trifluorobut-2-enamide (PubChem CID 110272456) has the molecular formula C16H11Cl2F3N2O and a molecular weight of 375.18 g/mol. Its IUPAC name is (Z)-3-(3-chloroanilino)-N-(3-chlorophenyl)-4,4,4-trifluorobut-2-enamide.
| Compound Name | (Z)-3-(3-chloroanilino)-N-(3-chlorophenyl)-4,4,4-trifluorobut-2-enamide |
|---|---|
| PubChem CID | 110272456 |
| Molecular Formula | C16H11Cl2F3N2O |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | (Z)-3-(3-chloroanilino)-N-(3-chlorophenyl)-4,4,4-trifluorobut-2-enamide |
| SMILES | O=C(/C=C(\Nc1cccc(Cl)c1)C(F)(F)F)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2F3N2O/c17-10-3-1-5-12(7-10)22-14(16(19,20)21)9-15(24)23-13-6-2-4-11(18)8-13/h1-9,22H,(H,23,24)/b14-9- |
| InChIKey | XIGMJSSDIPABFZ-ZROIWOOFSA-N |
| XLogP | 5.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|