C12H10ClF6NO — CID 3326093
N-(3-chlorophenyl)-2,2-bis(trifluoromethyl)butanamide (PubChem CID 3326093) has the molecular formula C12H10ClF6NO and a molecular weight of 333.66 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2,2-bis(trifluoromethyl)butanamide.
| Compound Name | N-(3-chlorophenyl)-2,2-bis(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 3326093 |
| Molecular Formula | C12H10ClF6NO |
| Molecular Weight | 333.66 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-(3-chlorophenyl)-2,2-bis(trifluoromethyl)butanamide |
| SMILES | CCC(C(=O)Nc1cccc(Cl)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF6NO/c1-2-10(11(14,15)16,12(17,18)19)9(21)20-8-5-3-4-7(13)6-8/h3-6H,2H2,1H3,(H,20,21) |
| InChIKey | YKSYDEPNEMPBAA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |