C9H7ClF2INO — CID 14154828
N-(3-chlorophenyl)-2,2-difluoro-3-iodopropanamide (PubChem CID 14154828) has the molecular formula C9H7ClF2INO and a molecular weight of 345.51 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2,2-difluoro-3-iodopropanamide.
| Compound Name | N-(3-chlorophenyl)-2,2-difluoro-3-iodopropanamide |
|---|---|
| PubChem CID | 14154828 |
| Molecular Formula | C9H7ClF2INO |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 344.92 |
| IUPAC Name | N-(3-chlorophenyl)-2,2-difluoro-3-iodopropanamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C(F)(F)CI |
| InChI | InChI=1S/C9H7ClF2INO/c10-6-2-1-3-7(4-6)14-8(15)9(11,12)5-13/h1-4H,5H2,(H,14,15) |
| InChIKey | BZQYMHZOISFRPP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|