C11H12ClN5O — CID 142932815
(E)-3,5-diamino-N-(3-chlorophenyl)-4,5-diiminopent-2-enamide (PubChem CID 142932815) has the molecular formula C11H12ClN5O and a molecular weight of 265.70 g/mol. Its IUPAC name is (E)-3,5-diamino-N-(3-chlorophenyl)-4,5-diiminopent-2-enamide.
| Compound Name | (E)-3,5-diamino-N-(3-chlorophenyl)-4,5-diiminopent-2-enamide |
|---|---|
| PubChem CID | 142932815 |
| Molecular Formula | C11H12ClN5O |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | (E)-3,5-diamino-N-(3-chlorophenyl)-4,5-diiminopent-2-enamide |
| SMILES | [H]/N=C(N)/C(=N\[H])C(/N)=C\C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H12ClN5O/c12-6-2-1-3-7(4-6)17-9(18)5-8(13)10(14)11(15)16/h1-5,14H,13H2,(H3,15,16)(H,17,18)/b8-5+,14-10- |
| InChIKey | GHCOUCRNECUBIR-OMPPTPSCSA-N |
| XLogP | 1.08 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|