C15H17ClN2O — CID 70502289
(3-chlorophenyl)urea;1,2-xylene (PubChem CID 70502289) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is (3-chlorophenyl)urea;1,2-xylene.
| Compound Name | (3-chlorophenyl)urea;1,2-xylene |
|---|---|
| PubChem CID | 70502289 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (3-chlorophenyl)urea;1,2-xylene |
| SMILES | Cc1ccccc1C.NC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C8H10.C7H7ClN2O/c1-7-5-3-4-6-8(7)2;8-5-2-1-3-6(4-5)10-7(9)11/h3-6H,1-2H3;1-4H,(H3,9,10,11) |
| InChIKey | ZGSSQJGUUWHRGV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |