C13H13F4NO — CID 12734388
(Z)-1-(dimethylamino)-4,4,5,5-tetrafluoro-1-phenylpent-1-en-3-one (PubChem CID 12734388) has the molecular formula C13H13F4NO and a molecular weight of 275.25 g/mol. Its IUPAC name is (Z)-1-(dimethylamino)-4,4,5,5-tetrafluoro-1-phenylpent-1-en-3-one.
| Compound Name | (Z)-1-(dimethylamino)-4,4,5,5-tetrafluoro-1-phenylpent-1-en-3-one |
|---|---|
| PubChem CID | 12734388 |
| Molecular Formula | C13H13F4NO |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (Z)-1-(dimethylamino)-4,4,5,5-tetrafluoro-1-phenylpent-1-en-3-one |
| SMILES | CN(C)/C(=C\C(=O)C(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H13F4NO/c1-18(2)10(9-6-4-3-5-7-9)8-11(19)13(16,17)12(14)15/h3-8,12H,1-2H3/b10-8- |
| InChIKey | ZPMKRJWLJBRULU-NTMALXAHSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|