C19H17ClF3NO2 — CID 175042650
4-(4-chloro-3-phenylmethoxyphenyl)-4-(dimethylamino)-1,1,1-trifluorobut-3-en-2-one (PubChem CID 175042650) has the molecular formula C19H17ClF3NO2 and a molecular weight of 383.80 g/mol. Its IUPAC name is 4-(4-chloro-3-phenylmethoxyphenyl)-4-(dimethylamino)-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | 4-(4-chloro-3-phenylmethoxyphenyl)-4-(dimethylamino)-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 175042650 |
| Molecular Formula | C19H17ClF3NO2 |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 4-(4-chloro-3-phenylmethoxyphenyl)-4-(dimethylamino)-1,1,1-trifluorobut-3-en-2-one |
| SMILES | CN(C)C(=CC(=O)C(F)(F)F)c1ccc(Cl)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H17ClF3NO2/c1-24(2)16(11-18(25)19(21,22)23)14-8-9-15(20)17(10-14)26-12-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3 |
| InChIKey | MTDUUSVWPCZEHN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|