C8H10F4OS — CID 5463572
(Z)-1,1,2,2-tetrafluoro-6-methyl-5-sulfanylhept-4-en-3-one (PubChem CID 5463572) has the molecular formula C8H10F4OS and a molecular weight of 230.23 g/mol. Its IUPAC name is (Z)-1,1,2,2-tetrafluoro-6-methyl-5-sulfanylhept-4-en-3-one.
| Compound Name | (Z)-1,1,2,2-tetrafluoro-6-methyl-5-sulfanylhept-4-en-3-one |
|---|---|
| PubChem CID | 5463572 |
| Molecular Formula | C8H10F4OS |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (Z)-1,1,2,2-tetrafluoro-6-methyl-5-sulfanylhept-4-en-3-one |
| SMILES | CC(C)/C(S)=C/C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H10F4OS/c1-4(2)5(14)3-6(13)8(11,12)7(9)10/h3-4,7,14H,1-2H3/b5-3- |
| InChIKey | UAKRIXYCJORWPW-HYXAFXHYSA-N |
| XLogP | 2.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|