C7H8F7NO — CID 104855040
2,2,3,3-tetrafluoro-N-(4,4,4-trifluorobutan-2-yl)propanamide (PubChem CID 104855040) has the molecular formula C7H8F7NO and a molecular weight of 255.13 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(4,4,4-trifluorobutan-2-yl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(4,4,4-trifluorobutan-2-yl)propanamide |
|---|---|
| PubChem CID | 104855040 |
| Molecular Formula | C7H8F7NO |
| Molecular Weight | 255.13 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(4,4,4-trifluorobutan-2-yl)propanamide |
| SMILES | CC(CC(F)(F)F)NC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H8F7NO/c1-3(2-6(10,11)12)15-5(16)7(13,14)4(8)9/h3-4H,2H2,1H3,(H,15,16) |
| InChIKey | MZBGTIZTFHRXMD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.13 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|