C10H15F4NO2 — CID 103769518
2,2,3,3-tetrafluoro-N-[1-(oxan-4-yl)ethyl]propanamide (PubChem CID 103769518) has the molecular formula C10H15F4NO2 and a molecular weight of 257.23 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[1-(oxan-4-yl)ethyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[1-(oxan-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 103769518 |
| Molecular Formula | C10H15F4NO2 |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[1-(oxan-4-yl)ethyl]propanamide |
| SMILES | CC(NC(=O)C(F)(F)C(F)F)C1CCOCC1 |
| InChI | InChI=1S/C10H15F4NO2/c1-6(7-2-4-17-5-3-7)15-9(16)10(13,14)8(11)12/h6-8H,2-5H2,1H3,(H,15,16) |
| InChIKey | VJDNKIDQEXJWIH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|