C12H22N2O2S — CID 114115167
3-amino-2,2-dimethyl-N-[1-(oxan-4-yl)ethyl]-3-sulfanylidenepropanamide (PubChem CID 114115167) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 3-amino-2,2-dimethyl-N-[1-(oxan-4-yl)ethyl]-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-2,2-dimethyl-N-[1-(oxan-4-yl)ethyl]-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 114115167 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-amino-2,2-dimethyl-N-[1-(oxan-4-yl)ethyl]-3-sulfanylidenepropanamide |
| SMILES | CC(NC(=O)C(C)(C)C(N)=S)C1CCOCC1 |
| InChI | InChI=1S/C12H22N2O2S/c1-8(9-4-6-16-7-5-9)14-11(15)12(2,3)10(13)17/h8-9H,4-7H2,1-3H3,(H2,13,17)(H,14,15) |
| InChIKey | GGWBOMWFRMFNNA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|