C6H9F4NO3 — CID 104580731
N-(1,3-dihydroxypropan-2-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 104580731) has the molecular formula C6H9F4NO3 and a molecular weight of 219.13 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 104580731 |
| Molecular Formula | C6H9F4NO3 |
| Molecular Weight | 219.13 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NC(CO)CO)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H9F4NO3/c7-4(8)6(9,10)5(14)11-3(1-12)2-13/h3-4,12-13H,1-2H2,(H,11,14) |
| InChIKey | YHDYNLIEABJXDR-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.13 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|