C10H13ClF2 — CID 175632174
(1Z,3E,5Z)-3-chloro-1,2-difluoro-5-propan-2-ylhepta-1,3,5-triene (PubChem CID 175632174) has the molecular formula C10H13ClF2 and a molecular weight of 206.66 g/mol. Its IUPAC name is (1Z,3E,5Z)-3-chloro-1,2-difluoro-5-propan-2-ylhepta-1,3,5-triene.
| Compound Name | (1Z,3E,5Z)-3-chloro-1,2-difluoro-5-propan-2-ylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 175632174 |
| Molecular Formula | C10H13ClF2 |
| Molecular Weight | 206.66 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (1Z,3E,5Z)-3-chloro-1,2-difluoro-5-propan-2-ylhepta-1,3,5-triene |
| SMILES | C/C=C(\C=C(Cl)/C(F)=C/F)C(C)C |
| InChI | InChI=1S/C10H13ClF2/c1-4-8(7(2)3)5-9(11)10(13)6-12/h4-7H,1-3H3/b8-4+,9-5+,10-6- |
| InChIKey | WBAKTVQTWOXETC-ALDZRQEWSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.66 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|