C12H20ClFN2 — CID 138514378
N-(1-chloroethenyl)-N'-[(2E,4E)-3-fluoro-5,6-dimethylhepta-2,4-dien-4-yl]methanediamine (PubChem CID 138514378) has the molecular formula C12H20ClFN2 and a molecular weight of 246.76 g/mol. Its IUPAC name is N-(1-chloroethenyl)-N'-[(2E,4E)-3-fluoro-5,6-dimethylhepta-2,4-dien-4-yl]methanediamine.
| Compound Name | N-(1-chloroethenyl)-N'-[(2E,4E)-3-fluoro-5,6-dimethylhepta-2,4-dien-4-yl]methanediamine |
|---|---|
| PubChem CID | 138514378 |
| Molecular Formula | C12H20ClFN2 |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | N-(1-chloroethenyl)-N'-[(2E,4E)-3-fluoro-5,6-dimethylhepta-2,4-dien-4-yl]methanediamine |
| SMILES | C=C(Cl)NCNC(/C(F)=C\C)=C(\C)C(C)C |
| InChI | InChI=1S/C12H20ClFN2/c1-6-11(14)12(9(4)8(2)3)16-7-15-10(5)13/h6,8,15-16H,5,7H2,1-4H3/b11-6+,12-9+ |
| InChIKey | VFYOLDQYDXFCAP-MOPWJCKASA-N |
| XLogP | 3.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|