C6H3F9 — CID 21182215
1,1,2,3,3,4,5,6,6-nonafluorohex-1-ene (PubChem CID 21182215) has the molecular formula C6H3F9 and a molecular weight of 246.07 g/mol. Its IUPAC name is 1,1,2,3,3,4,5,6,6-nonafluorohex-1-ene.
| Compound Name | 1,1,2,3,3,4,5,6,6-nonafluorohex-1-ene |
|---|---|
| PubChem CID | 21182215 |
| Molecular Formula | C6H3F9 |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 1,1,2,3,3,4,5,6,6-nonafluorohex-1-ene |
| SMILES | FC(F)=C(F)C(F)(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C6H3F9/c7-1(4(10)11)2(8)6(14,15)3(9)5(12)13/h1-2,4H |
| InChIKey | NIJWXHXLSDWSPV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |