C3H2F4 — CID 11855995
1,1,2,3-tetrafluoroprop-1-ene (PubChem CID 11855995) has the molecular formula C3H2F4 and a molecular weight of 114.04 g/mol. Its IUPAC name is 1,1,2,3-tetrafluoroprop-1-ene.
| Compound Name | 1,1,2,3-tetrafluoroprop-1-ene |
|---|---|
| PubChem CID | 11855995 |
| Molecular Formula | C3H2F4 |
| Molecular Weight | 114.04 g/mol |
| Exact Mass | 114.01 |
| IUPAC Name | 1,1,2,3-tetrafluoroprop-1-ene |
| SMILES | FCC(F)=C(F)F |
| InChI | InChI=1S/C3H2F4/c4-1-2(5)3(6)7/h1H2 |
| InChIKey | PGJHURKAWUJHLJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.04 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |