C6H7F4NO — CID 159835031
prop-2-enamide;1,1,2,3-tetrafluoroprop-1-ene (PubChem CID 159835031) has the molecular formula C6H7F4NO and a molecular weight of 185.12 g/mol. Its IUPAC name is prop-2-enamide;1,1,2,3-tetrafluoroprop-1-ene.
| Compound Name | prop-2-enamide;1,1,2,3-tetrafluoroprop-1-ene |
|---|---|
| PubChem CID | 159835031 |
| Molecular Formula | C6H7F4NO |
| Molecular Weight | 185.12 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | prop-2-enamide;1,1,2,3-tetrafluoroprop-1-ene |
| SMILES | C=CC(N)=O.FCC(F)=C(F)F |
| InChI | InChI=1S/C3H2F4.C3H5NO/c4-1-2(5)3(6)7;1-2-3(4)5/h1H2;2H,1H2,(H2,4,5) |
| InChIKey | NNYLCQQNAFMEOJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.12 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|