About 3-methylocta-1,2-dien-4-amine
3-methylocta-1,2-dien-4-amine (PubChem CID 55285036) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 3-methylocta-1,2-dien-4-amine.
Molecular Properties
| Compound Name | 3-methylocta-1,2-dien-4-amine |
| PubChem CID | 55285036 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 3-methylocta-1,2-dien-4-amine |
| SMILES | C=C=C(C)C(N)CCCC |
| InChI | InChI=1S/C9H17N/c1-4-6-7-9(10)8(3)5-2/h9H,2,4,6-7,10H2,1,3H3 |
| InChIKey | ZKQCCMZFJJTQNG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylocta-1,2-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylocta-1,2-dien-4-amine?
The IUPAC name of 3-methylocta-1,2-dien-4-amine (CID 55285036) is 3-methylocta-1,2-dien-4-amine.
What is the SMILES notation for 3-methylocta-1,2-dien-4-amine?
The canonical SMILES for 3-methylocta-1,2-dien-4-amine is C=C=C(C)C(N)CCCC.
What is the InChIKey of 3-methylocta-1,2-dien-4-amine?
The InChIKey is ZKQCCMZFJJTQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-4-6-7-9(10)8(3)5-2/h9H,2,4,6-7,10H2,1,3H3.
What are the key properties of 3-methylocta-1,2-dien-4-amine?
3-methylocta-1,2-dien-4-amine has a molecular weight of 139.24 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylocta-1,2-dien-4-amine is sourced from PubChem (CID 55285036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).