C17H34 — CID 143173794
ethane;3-methyl-4-propylundeca-1,2-diene (PubChem CID 143173794) has the molecular formula C17H34 and a molecular weight of 238.46 g/mol. Its IUPAC name is ethane;3-methyl-4-propylundeca-1,2-diene.
| Compound Name | ethane;3-methyl-4-propylundeca-1,2-diene |
|---|---|
| PubChem CID | 143173794 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | ethane;3-methyl-4-propylundeca-1,2-diene |
| SMILES | C=C=C(C)C(CCC)CCCCCCC.CC |
| InChI | InChI=1S/C15H28.C2H6/c1-5-8-9-10-11-13-15(12-6-2)14(4)7-3;1-2/h15H,3,5-6,8-13H2,1-2,4H3;1-2H3 |
| InChIKey | RTXSGCUUFKCXFP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|