About 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane
1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane (PubChem CID 142096766) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane.
Analyze 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane?
The IUPAC name of 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane (CID 142096766) is 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane.
What is the SMILES notation for 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane?
The canonical SMILES for 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane is C=C=C(C)CCC1(C)CCCCC1.
What is the InChIKey of 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane?
The InChIKey is IYAKOSWHVQOWRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-4-12(2)8-11-13(3)9-6-5-7-10-13/h1,5-11H2,2-3H3.
What are the key properties of 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane?
1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane has a molecular weight of 178.32 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-(3-methylpenta-3,4-dienyl)cyclohexane is sourced from PubChem (CID 142096766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).