C11H20 — CID 123384763
3,7-dimethylnona-1,2-diene (PubChem CID 123384763) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is 3,7-dimethylnona-1,2-diene.
| Compound Name | 3,7-dimethylnona-1,2-diene |
|---|---|
| PubChem CID | 123384763 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 3,7-dimethylnona-1,2-diene |
| SMILES | C=C=C(C)CCCC(C)CC |
| InChI | InChI=1S/C11H20/c1-5-10(3)8-7-9-11(4)6-2/h11H,1,6-9H2,2-4H3 |
| InChIKey | NIZUHLXVGDPFLM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |