About 3,7-dimethylnona-1,2-diene
3,7-dimethylnona-1,2-diene (PubChem CID 123384763) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is 3,7-dimethylnona-1,2-diene.
Molecular Properties
| Compound Name | 3,7-dimethylnona-1,2-diene |
| PubChem CID | 123384763 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 3,7-dimethylnona-1,2-diene |
| SMILES | C=C=C(C)CCCC(C)CC |
| InChI | InChI=1S/C11H20/c1-5-10(3)8-7-9-11(4)6-2/h11H,1,6-9H2,2-4H3 |
| InChIKey | NIZUHLXVGDPFLM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,7-dimethylnona-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethylnona-1,2-diene?
The IUPAC name of 3,7-dimethylnona-1,2-diene (CID 123384763) is 3,7-dimethylnona-1,2-diene.
What is the SMILES notation for 3,7-dimethylnona-1,2-diene?
The canonical SMILES for 3,7-dimethylnona-1,2-diene is C=C=C(C)CCCC(C)CC.
What is the InChIKey of 3,7-dimethylnona-1,2-diene?
The InChIKey is NIZUHLXVGDPFLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20/c1-5-10(3)8-7-9-11(4)6-2/h11H,1,6-9H2,2-4H3.
What are the key properties of 3,7-dimethylnona-1,2-diene?
3,7-dimethylnona-1,2-diene has a molecular weight of 152.28 g/mol, XLogP of 3.93, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethylnona-1,2-diene is sourced from PubChem (CID 123384763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).