About prop-1-ene-2-tellurol
prop-1-ene-2-tellurol (PubChem CID 102012383) has the molecular formula C3H6Te
and a molecular weight of 169.68 g/mol. Its IUPAC name is prop-1-ene-2-tellurol.
Molecular Properties
| Compound Name | prop-1-ene-2-tellurol |
| PubChem CID | 102012383 |
| Molecular Formula | C3H6Te |
| Molecular Weight | 169.68 g/mol |
| Exact Mass | 171.95 |
| IUPAC Name | prop-1-ene-2-tellurol |
| SMILES | C=C(C)[TeH] |
| InChI | InChI=1S/C3H6Te/c1-3(2)4/h4H,1H2,2H3 |
| InChIKey | PYTBQISGFSWKDL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.68 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze prop-1-ene-2-tellurol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-ene-2-tellurol?
The IUPAC name of prop-1-ene-2-tellurol (CID 102012383) is prop-1-ene-2-tellurol.
What is the SMILES notation for prop-1-ene-2-tellurol?
The canonical SMILES for prop-1-ene-2-tellurol is C=C(C)[TeH].
What is the InChIKey of prop-1-ene-2-tellurol?
The InChIKey is PYTBQISGFSWKDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6Te/c1-3(2)4/h4H,1H2,2H3.
What are the key properties of prop-1-ene-2-tellurol?
prop-1-ene-2-tellurol has a molecular weight of 169.68 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-ene-2-tellurol is sourced from PubChem (CID 102012383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).