C9H13N — CID 176530983
(2E)-4-methylideneocta-2,5,6-trien-2-amine (PubChem CID 176530983) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (2E)-4-methylideneocta-2,5,6-trien-2-amine.
| Compound Name | (2E)-4-methylideneocta-2,5,6-trien-2-amine |
|---|---|
| PubChem CID | 176530983 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (2E)-4-methylideneocta-2,5,6-trien-2-amine |
| SMILES | C=C(C=C=CC)/C=C(\C)N |
| InChI | InChI=1S/C9H13N/c1-4-5-6-8(2)7-9(3)10/h4,6-7H,2,10H2,1,3H3/b9-7+ |
| InChIKey | UDPYVHYFIHEQKT-VQHVLOKHSA-N |
| XLogP | 2.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|