C8H11N — CID 134515463
(3E)-octa-1,3,5,6-tetraen-3-amine (PubChem CID 134515463) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is (3E)-octa-1,3,5,6-tetraen-3-amine.
| Compound Name | (3E)-octa-1,3,5,6-tetraen-3-amine |
|---|---|
| PubChem CID | 134515463 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (3E)-octa-1,3,5,6-tetraen-3-amine |
| SMILES | C=C/C(N)=C\C=C=CC |
| InChI | InChI=1S/C8H11N/c1-3-5-6-7-8(9)4-2/h3-4,6-7H,2,9H2,1H3/b8-7+ |
| InChIKey | NVEFVXJRVSHKSZ-BQYQJAHWSA-N |
| XLogP | 1.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|