C14H17NO2 — CID 176531923
(2E,5Z)-2-[(E)-1-aminoprop-1-enyl]-4-methylidenedeca-2,5,7,8-tetraenoic acid (PubChem CID 176531923) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is (2E,5Z)-2-[(E)-1-aminoprop-1-enyl]-4-methylidenedeca-2,5,7,8-tetraenoic acid.
| Compound Name | (2E,5Z)-2-[(E)-1-aminoprop-1-enyl]-4-methylidenedeca-2,5,7,8-tetraenoic acid |
|---|---|
| PubChem CID | 176531923 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (2E,5Z)-2-[(E)-1-aminoprop-1-enyl]-4-methylidenedeca-2,5,7,8-tetraenoic acid |
| SMILES | C=C(/C=C\C=C=CC)/C=C(C(=O)O)\C(N)=C/C |
| InChI | InChI=1S/C14H17NO2/c1-4-6-7-8-9-11(3)10-12(14(16)17)13(15)5-2/h4-5,7-10H,3,15H2,1-2H3,(H,16,17)/b9-8-,12-10+,13-5- |
| InChIKey | PHCURKJMBIJKQF-MBAWAFCQSA-N |
| XLogP | 2.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|