2-aminopenta-2,3-dienoic acid

C5H7NO2 — CID 176526137

IUPAC2-aminopenta-2,3-dienoic acid
SMILESCC=C=C(N)C(=O)O
InChIInChI=1S/C5H7NO2/c1-2-3-4(6)5(7)8/h2H,6H2,1H3,(H,7,8)
InChIKeyUTWWPFKTKSBOKE-UHFFFAOYSA-N
MW113.12 g/mol
LogP0.09
Rot. Bonds1

About 2-aminopenta-2,3-dienoic acid

2-aminopenta-2,3-dienoic acid (PubChem CID 176526137) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is 2-aminopenta-2,3-dienoic acid.

Molecular Properties

Compound Name2-aminopenta-2,3-dienoic acid
PubChem CID176526137
Molecular FormulaC5H7NO2
Molecular Weight113.12 g/mol
Exact Mass113.05
IUPAC Name2-aminopenta-2,3-dienoic acid
SMILESCC=C=C(N)C(=O)O
InChIInChI=1S/C5H7NO2/c1-2-3-4(6)5(7)8/h2H,6H2,1H3,(H,7,8)
InChIKeyUTWWPFKTKSBOKE-UHFFFAOYSA-N
XLogP0.09
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500113.12
LogP ≤ 50.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-aminopenta-2,3-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminopenta-2,3-dienoic acid?
The IUPAC name of 2-aminopenta-2,3-dienoic acid (CID 176526137) is 2-aminopenta-2,3-dienoic acid.
What is the SMILES notation for 2-aminopenta-2,3-dienoic acid?
The canonical SMILES for 2-aminopenta-2,3-dienoic acid is CC=C=C(N)C(=O)O.
What is the InChIKey of 2-aminopenta-2,3-dienoic acid?
The InChIKey is UTWWPFKTKSBOKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2/c1-2-3-4(6)5(7)8/h2H,6H2,1H3,(H,7,8).
What are the key properties of 2-aminopenta-2,3-dienoic acid?
2-aminopenta-2,3-dienoic acid has a molecular weight of 113.12 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopenta-2,3-dienoic acid is sourced from PubChem (CID 176526137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).