C5H7NO2 — CID 176526137
2-aminopenta-2,3-dienoic acid (PubChem CID 176526137) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is 2-aminopenta-2,3-dienoic acid.
| Compound Name | 2-aminopenta-2,3-dienoic acid |
|---|---|
| PubChem CID | 176526137 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 2-aminopenta-2,3-dienoic acid |
| SMILES | CC=C=C(N)C(=O)O |
| InChI | InChI=1S/C5H7NO2/c1-2-3-4(6)5(7)8/h2H,6H2,1H3,(H,7,8) |
| InChIKey | UTWWPFKTKSBOKE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|