About carbonic acid;oxamic acid
carbonic acid;oxamic acid (PubChem CID 87882042) has the molecular formula C3H5NO6
and a molecular weight of 151.07 g/mol. Its IUPAC name is carbonic acid;oxamic acid.
Molecular Properties
| Compound Name | carbonic acid;oxamic acid |
| PubChem CID | 87882042 |
| Molecular Formula | C3H5NO6 |
| Molecular Weight | 151.07 g/mol |
| Exact Mass | 151.01 |
| IUPAC Name | carbonic acid;oxamic acid |
| SMILES | NC(=O)C(=O)O.O=C(O)O |
| InChI | InChI=1S/C2H3NO3.CH2O3/c3-1(4)2(5)6;2-1(3)4/h(H2,3,4)(H,5,6);(H2,2,3,4) |
| InChIKey | MFVMDWACFGRWAP-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.07 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;oxamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;oxamic acid?
The IUPAC name of carbonic acid;oxamic acid (CID 87882042) is carbonic acid;oxamic acid.
What is the SMILES notation for carbonic acid;oxamic acid?
The canonical SMILES for carbonic acid;oxamic acid is NC(=O)C(=O)O.O=C(O)O.
What is the InChIKey of carbonic acid;oxamic acid?
The InChIKey is MFVMDWACFGRWAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NO3.CH2O3/c3-1(4)2(5)6;2-1(3)4/h(H2,3,4)(H,5,6);(H2,2,3,4).
What are the key properties of carbonic acid;oxamic acid?
carbonic acid;oxamic acid has a molecular weight of 151.07 g/mol, XLogP of -1.22, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;oxamic acid is sourced from PubChem (CID 87882042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).