carbonic acid;oxamic acid

C3H5NO6 — CID 87882042

IUPACcarbonic acid;oxamic acid
SMILESNC(=O)C(=O)O.O=C(O)O
InChIInChI=1S/C2H3NO3.CH2O3/c3-1(4)2(5)6;2-1(3)4/h(H2,3,4)(H,5,6);(H2,2,3,4)
InChIKeyMFVMDWACFGRWAP-UHFFFAOYSA-N
MW151.07 g/mol
LogP-1.22
Rot. Bonds

About carbonic acid;oxamic acid

carbonic acid;oxamic acid (PubChem CID 87882042) has the molecular formula C3H5NO6 and a molecular weight of 151.07 g/mol. Its IUPAC name is carbonic acid;oxamic acid.

Molecular Properties

Compound Namecarbonic acid;oxamic acid
PubChem CID87882042
Molecular FormulaC3H5NO6
Molecular Weight151.07 g/mol
Exact Mass151.01
IUPAC Namecarbonic acid;oxamic acid
SMILESNC(=O)C(=O)O.O=C(O)O
InChIInChI=1S/C2H3NO3.CH2O3/c3-1(4)2(5)6;2-1(3)4/h(H2,3,4)(H,5,6);(H2,2,3,4)
InChIKeyMFVMDWACFGRWAP-UHFFFAOYSA-N
XLogP-1.22
TPSA137.92 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.07
LogP ≤ 5-1.22
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze carbonic acid;oxamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonic acid;oxamic acid?
The IUPAC name of carbonic acid;oxamic acid (CID 87882042) is carbonic acid;oxamic acid.
What is the SMILES notation for carbonic acid;oxamic acid?
The canonical SMILES for carbonic acid;oxamic acid is NC(=O)C(=O)O.O=C(O)O.
What is the InChIKey of carbonic acid;oxamic acid?
The InChIKey is MFVMDWACFGRWAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NO3.CH2O3/c3-1(4)2(5)6;2-1(3)4/h(H2,3,4)(H,5,6);(H2,2,3,4).
What are the key properties of carbonic acid;oxamic acid?
carbonic acid;oxamic acid has a molecular weight of 151.07 g/mol, XLogP of -1.22, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;oxamic acid is sourced from PubChem (CID 87882042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).